C18H21N3O — CID 94485231
1-[(2R)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone (PubChem CID 94485231) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-[(2R)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
|---|---|
| PubChem CID | 94485231 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[(2R)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCC[C@@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H21N3O/c22-17(12-13-6-1-2-7-13)21-11-5-10-16(21)18-19-14-8-3-4-9-15(14)20-18/h1,3-4,6,8-9,13,16H,2,5,7,10-12H2,(H,19,20)/t13-,16+/m0/s1 |
| InChIKey | LBRUODHYZOIDPT-XJKSGUPXSA-N |
| XLogP | 3.58 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|