C18H20N2OS — CID 41411146
1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone (PubChem CID 41411146) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
|---|---|
| PubChem CID | 41411146 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H20N2OS/c21-17(12-13-6-1-2-7-13)20-11-5-9-15(20)18-19-14-8-3-4-10-16(14)22-18/h1,3-4,6,8,10,13,15H,2,5,7,9,11-12H2/t13-,15+/m0/s1 |
| InChIKey | NHTWPHUTAKFJDR-DZGCQCFKSA-N |
| XLogP | 4.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|