C10H18N4O3 — CID 136764975
5-amino-4-[3-(2-methoxyethoxy)propylamino]-1H-pyrimidin-6-one (PubChem CID 136764975) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 5-amino-4-[3-(2-methoxyethoxy)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[3-(2-methoxyethoxy)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136764975 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 5-amino-4-[3-(2-methoxyethoxy)propylamino]-1H-pyrimidin-6-one |
| SMILES | COCCOCCCNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C10H18N4O3/c1-16-5-6-17-4-2-3-12-9-8(11)10(15)14-7-13-9/h7H,2-6,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | YXTJLWWZVQWWSF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|