About CID 136765122
CID 136765122 (PubChem CID 136765122) has the molecular formula C30H49O2Si
and a molecular weight of 469.81 g/mol.
Molecular Properties
| Compound Name | CID 136765122 |
| PubChem CID | 136765122 |
| Molecular Formula | C30H49O2Si |
| Molecular Weight | 469.81 g/mol |
| Exact Mass | 469.35 |
| IUPAC Name | — |
| SMILES | C[C@H](CCC1OC1(C)C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O[Si])C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H49O2Si/c1-19(9-12-25-27(4,5)31-25)20-13-17-30(8)22-10-11-23-26(2,3)24(32-33)15-16-28(23,6)21(22)14-18-29(20,30)7/h19-20,23-25H,9-18H2,1-8H3/t19-,20-,23+,24+,25?,28-,29-,30+/m1/s1 |
| InChIKey | SJYILAFXIQLFLE-HICKBLNCSA-N |
| XLogP | 7.80 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.81 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 136765122 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136765122?
The IUPAC name of CID 136765122 (CID 136765122) is not available.
What is the SMILES notation for CID 136765122?
The canonical SMILES for CID 136765122 is C[C@H](CCC1OC1(C)C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O[Si])C(C)(C)[C@@H]1CC3.
What is the InChIKey of CID 136765122?
The InChIKey is SJYILAFXIQLFLE-HICKBLNCSA-N. The full InChI is InChI=1S/C30H49O2Si/c1-19(9-12-25-27(4,5)31-25)20-13-17-30(8)22-10-11-23-26(2,3)24(32-33)15-16-28(23,6)21(22)14-18-29(20,30)7/h19-20,23-25H,9-18H2,1-8H3/t19-,20-,23+,24+,25?,28-,29-,30+/m1/s1.
What are the key properties of CID 136765122?
CID 136765122 has a molecular weight of 469.81 g/mol, XLogP of 7.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136765122 is sourced from PubChem (CID 136765122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).