C17H11Br2NO2 — CID 136765269
2-[(Z)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]quinolin-8-ol (PubChem CID 136765269) has the molecular formula C17H11Br2NO2 and a molecular weight of 421.09 g/mol. Its IUPAC name is 2-[(Z)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]quinolin-8-ol.
| Compound Name | 2-[(Z)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 136765269 |
| Molecular Formula | C17H11Br2NO2 |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | 2-[(Z)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]quinolin-8-ol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=C\c1ccc2cccc(O)c2n1 |
| InChI | InChI=1S/C17H11Br2NO2/c18-12-8-11(17(22)14(19)9-12)5-7-13-6-4-10-2-1-3-15(21)16(10)20-13/h1-9,21-22H/b7-5- |
| InChIKey | RPWDPJBSGSHYCB-ALCCZGGFSA-N |
| XLogP | 5.34 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |