C11H11N3O — CID 136765356
2-(3,5-diamino-2-pyridinyl)phenol (PubChem CID 136765356) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(3,5-diamino-2-pyridinyl)phenol.
| Compound Name | 2-(3,5-diamino-2-pyridinyl)phenol |
|---|---|
| PubChem CID | 136765356 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(3,5-diamino-2-pyridinyl)phenol |
| SMILES | Nc1cnc(-c2ccccc2O)c(N)c1 |
| InChI | InChI=1S/C11H11N3O/c12-7-5-9(13)11(14-6-7)8-3-1-2-4-10(8)15/h1-6,15H,12-13H2 |
| InChIKey | SHRWNDSICZUYPJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |