C17H17N5O — CID 136766338
6-[[(1S)-cyclohex-3-en-1-yl]amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136766338) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 6-[[(1S)-cyclohex-3-en-1-yl]amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[[(1S)-cyclohex-3-en-1-yl]amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136766338 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 6-[[(1S)-cyclohex-3-en-1-yl]amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N[C@@H]2CC=CCC2)nc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C17H17N5O/c23-16-14-11-18-22(13-9-5-2-6-10-13)15(14)20-17(21-16)19-12-7-3-1-4-8-12/h1-3,5-6,9-12H,4,7-8H2,(H2,19,20,21,23)/t12-/m1/s1 |
| InChIKey | RVRRUYXAZNXAAK-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|