C21H27N5O2 — CID 137273800
6-[(2-pentan-3-yloxan-4-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137273800) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-[(2-pentan-3-yloxan-4-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(2-pentan-3-yloxan-4-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137273800 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 6-[(2-pentan-3-yloxan-4-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCC(CC)C1CC(Nc2nc3c(cnn3-c3ccccc3)c(=O)[nH]2)CCO1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-14(4-2)18-12-15(10-11-28-18)23-21-24-19-17(20(27)25-21)13-22-26(19)16-8-6-5-7-9-16/h5-9,13-15,18H,3-4,10-12H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | MDXIIHVPXASBTL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |