C18H18ClN3O2S — CID 136766646
2-[(5R)-2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]imino]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 136766646) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-[(5R)-2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]imino]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]imino]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 136766646 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-[(5R)-2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]imino]-4-oxo-1,3-thiazolidin-5-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\[C@H]2C[C@H]3C=C[C@H]2C3)NC1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H18ClN3O2S/c19-12-3-1-2-4-13(12)20-16(23)9-15-17(24)22-18(25-15)21-14-8-10-5-6-11(14)7-10/h1-6,10-11,14-15H,7-9H2,(H,20,23)(H,21,22,24)/t10-,11-,14-,15+/m0/s1 |
| InChIKey | BOKVJFHTLJCVEB-LWWSYDQCSA-N |
| XLogP | 3.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|