C10H16ClN3O — CID 136768843
5-chloro-4-(2,2-dimethylbutylamino)-1H-pyrimidin-6-one (PubChem CID 136768843) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 5-chloro-4-(2,2-dimethylbutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,2-dimethylbutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136768843 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 5-chloro-4-(2,2-dimethylbutylamino)-1H-pyrimidin-6-one |
| SMILES | CCC(C)(C)CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H16ClN3O/c1-4-10(2,3)5-12-8-7(11)9(15)14-6-13-8/h6H,4-5H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | JUNBHAPZYJQHNA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |