C28H40BrNO3 — CID 136772010
(5S,8R,9S,10S,13S,14S,17S)-17-[[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 136772010) has the molecular formula C28H40BrNO3 and a molecular weight of 518.54 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17S)-17-[[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (5S,8R,9S,10S,13S,14S,17S)-17-[[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 136772010 |
| Molecular Formula | C28H40BrNO3 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-17-[[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COc1cc(Br)cc(/C=N/C[C@]2(O)CC[C@H]3[C@@H]4CC[C@@H]5CCCC[C@]5(C)[C@H]4CC[C@@]32C)c1O |
| InChI | InChI=1S/C28H40BrNO3/c1-26-11-5-4-6-19(26)7-8-21-22(26)9-12-27(2)23(21)10-13-28(27,32)17-30-16-18-14-20(29)15-24(33-3)25(18)31/h14-16,19,21-23,31-32H,4-13,17H2,1-3H3/b30-16+/t19-,21+,22-,23-,26-,27-,28+/m0/s1 |
| InChIKey | TVDJZFBATLLPAM-VSPXQVDMSA-N |
| XLogP | 6.75 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|