C8H11BrClN3O — CID 136772481
5-bromo-4-(4-chlorobutylamino)-1H-pyrimidin-6-one (PubChem CID 136772481) has the molecular formula C8H11BrClN3O and a molecular weight of 280.55 g/mol. Its IUPAC name is 5-bromo-4-(4-chlorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(4-chlorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136772481 |
| Molecular Formula | C8H11BrClN3O |
| Molecular Weight | 280.55 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 5-bromo-4-(4-chlorobutylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCCCl)c1Br |
| InChI | InChI=1S/C8H11BrClN3O/c9-6-7(11-4-2-1-3-10)12-5-13-8(6)14/h5H,1-4H2,(H2,11,12,13,14) |
| InChIKey | OQMXMTTVTBSJDS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|