C11H17BrClN3O — CID 136817748
5-bromo-4-[(2-chloro-3-ethylpentyl)amino]-1H-pyrimidin-6-one (PubChem CID 136817748) has the molecular formula C11H17BrClN3O and a molecular weight of 322.63 g/mol. Its IUPAC name is 5-bromo-4-[(2-chloro-3-ethylpentyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(2-chloro-3-ethylpentyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136817748 |
| Molecular Formula | C11H17BrClN3O |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 5-bromo-4-[(2-chloro-3-ethylpentyl)amino]-1H-pyrimidin-6-one |
| SMILES | CCC(CC)C(Cl)CNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H17BrClN3O/c1-3-7(4-2)8(13)5-14-10-9(12)11(17)16-6-15-10/h6-8H,3-5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | KENJPIHAJVUONT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|