C18H14F2N2O3 — CID 136773108
7-fluoro-6-(4-fluorophenoxy)-2-[(3S)-oxolan-3-yl]-3H-quinazolin-4-one (PubChem CID 136773108) has the molecular formula C18H14F2N2O3 and a molecular weight of 344.32 g/mol. Its IUPAC name is 7-fluoro-6-(4-fluorophenoxy)-2-[(3S)-oxolan-3-yl]-3H-quinazolin-4-one.
| Compound Name | 7-fluoro-6-(4-fluorophenoxy)-2-[(3S)-oxolan-3-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136773108 |
| Molecular Formula | C18H14F2N2O3 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 7-fluoro-6-(4-fluorophenoxy)-2-[(3S)-oxolan-3-yl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c([C@@H]2CCOC2)nc2cc(F)c(Oc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C18H14F2N2O3/c19-11-1-3-12(4-2-11)25-16-7-13-15(8-14(16)20)21-17(22-18(13)23)10-5-6-24-9-10/h1-4,7-8,10H,5-6,9H2,(H,21,22,23)/t10-/m1/s1 |
| InChIKey | LZEKXRKYARSGRP-SNVBAGLBSA-N |
| XLogP | 3.50 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |