C15H17ClN2O3 — CID 136506679
2-(3-chloro-3-methylcyclobutyl)-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 136506679) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(3-chloro-3-methylcyclobutyl)-6,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-(3-chloro-3-methylcyclobutyl)-6,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136506679 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(3-chloro-3-methylcyclobutyl)-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | COc1cc2nc(C3CC(C)(Cl)C3)[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C15H17ClN2O3/c1-15(16)6-8(7-15)13-17-10-5-12(21-3)11(20-2)4-9(10)14(19)18-13/h4-5,8H,6-7H2,1-3H3,(H,17,18,19) |
| InChIKey | SIMXGJIFDMXJBZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|