C11H16N4O3 — CID 136776191
2-[1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidin-4-yl]acetic acid (PubChem CID 136776191) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 136776191 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[1-(2-amino-6-oxo-1H-pyrimidin-4-yl)piperidin-4-yl]acetic acid |
| SMILES | Nc1nc(N2CCC(CC(=O)O)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H16N4O3/c12-11-13-8(6-9(16)14-11)15-3-1-7(2-4-15)5-10(17)18/h6-7H,1-5H2,(H,17,18)(H3,12,13,14,16) |
| InChIKey | GKFIUXMFZKKPON-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |