C25H28N4O3 — CID 136779116
butyl 4-[(6-benzyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)amino]benzoate (PubChem CID 136779116) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is butyl 4-[(6-benzyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)amino]benzoate.
| Compound Name | butyl 4-[(6-benzyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 136779116 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | butyl 4-[(6-benzyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(Nc2nc3c(c(=O)[nH]2)CN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-2-3-15-32-24(31)19-9-11-20(12-10-19)26-25-27-22-13-14-29(17-21(22)23(30)28-25)16-18-7-5-4-6-8-18/h4-12H,2-3,13-17H2,1H3,(H2,26,27,28,30) |
| InChIKey | VCUMIGVGRQGPSN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|