C22H22ClN5O3 — CID 136788424
6-benzyl-2-[(2Z)-2-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136788424) has the molecular formula C22H22ClN5O3 and a molecular weight of 439.90 g/mol. Its IUPAC name is 6-benzyl-2-[(2Z)-2-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-benzyl-2-[(2Z)-2-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136788424 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 6-benzyl-2-[(2Z)-2-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cc(/C=N\Nc2nc3c(c(=O)[nH]2)CN(Cc2ccccc2)CC3)cc(Cl)c1O |
| InChI | InChI=1S/C22H22ClN5O3/c1-31-19-10-15(9-17(23)20(19)29)11-24-27-22-25-18-7-8-28(13-16(18)21(30)26-22)12-14-5-3-2-4-6-14/h2-6,9-11,29H,7-8,12-13H2,1H3,(H2,25,26,27,30)/b24-11- |
| InChIKey | ACJUYOYFQJBGOU-MYKKPKGFSA-N |
| XLogP | 3.14 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|