C26H28N6O — CID 136788513
6-benzyl-2-[(2Z)-2-[(1-ethyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136788513) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 6-benzyl-2-[(2Z)-2-[(1-ethyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-benzyl-2-[(2Z)-2-[(1-ethyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136788513 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 6-benzyl-2-[(2Z)-2-[(1-ethyl-2-methylindol-3-yl)methylidene]hydrazinyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCn1c(C)c(/C=N\Nc2nc3c(c(=O)[nH]2)CN(Cc2ccccc2)CC3)c2ccccc21 |
| InChI | InChI=1S/C26H28N6O/c1-3-32-18(2)21(20-11-7-8-12-24(20)32)15-27-30-26-28-23-13-14-31(17-22(23)25(33)29-26)16-19-9-5-4-6-10-19/h4-12,15H,3,13-14,16-17H2,1-2H3,(H2,28,29,30,33)/b27-15- |
| InChIKey | NCVQXWBLYORXLH-DICXZTSXSA-N |
| XLogP | 4.06 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|