C15H11Cl2N3O4 — CID 136781897
4-(5,6-dichloro-1H-benzimidazol-2-yl)-2-ethoxy-6-nitrophenol (PubChem CID 136781897) has the molecular formula C15H11Cl2N3O4 and a molecular weight of 368.18 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-2-ethoxy-6-nitrophenol.
| Compound Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-2-ethoxy-6-nitrophenol |
|---|---|
| PubChem CID | 136781897 |
| Molecular Formula | C15H11Cl2N3O4 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-2-ethoxy-6-nitrophenol |
| SMILES | CCOc1cc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H11Cl2N3O4/c1-2-24-13-4-7(3-12(14(13)21)20(22)23)15-18-10-5-8(16)9(17)6-11(10)19-15/h3-6,21H,2H2,1H3,(H,18,19) |
| InChIKey | XMBUOHZGSPQBPZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|