C19H13ClF6N4O2 — CID 136785988
(5S,7S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136785988) has the molecular formula C19H13ClF6N4O2 and a molecular weight of 478.78 g/mol. Its IUPAC name is (5S,7S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136785988 |
| Molecular Formula | C19H13ClF6N4O2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (5S,7S)-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cnn2c1N[C@H](c1ccco1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C19H13ClF6N4O2/c20-12-4-3-9(6-11(12)18(21,22)23)28-17(31)10-8-27-30-15(19(24,25)26)7-13(29-16(10)30)14-2-1-5-32-14/h1-6,8,13,15,29H,7H2,(H,28,31)/t13-,15-/m0/s1 |
| InChIKey | ZKIKCANHBKTUFA-ZFWWWQNUSA-N |
| XLogP | 6.06 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |