C18H14BrF3N4O3 — CID 136792507
(5R,7R)-N-(5-bromo-2-hydroxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136792507) has the molecular formula C18H14BrF3N4O3 and a molecular weight of 471.23 g/mol. Its IUPAC name is (5R,7R)-N-(5-bromo-2-hydroxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-(5-bromo-2-hydroxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136792507 |
| Molecular Formula | C18H14BrF3N4O3 |
| Molecular Weight | 471.23 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | (5R,7R)-N-(5-bromo-2-hydroxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1O)c1cnn2c1N[C@@H](c1ccco1)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C18H14BrF3N4O3/c19-9-3-4-13(27)11(6-9)25-17(28)10-8-23-26-15(18(20,21)22)7-12(24-16(10)26)14-2-1-5-29-14/h1-6,8,12,15,24,27H,7H2,(H,25,28)/t12-,15-/m1/s1 |
| InChIKey | SJYAHBZSMSHSIC-IUODEOHRSA-N |
| XLogP | 4.86 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|