C12H10BrClN4O2 — CID 136787482
5-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-chloro-2-methylpyridazin-3-one (PubChem CID 136787482) has the molecular formula C12H10BrClN4O2 and a molecular weight of 357.60 g/mol. Its IUPAC name is 5-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-chloro-2-methylpyridazin-3-one.
| Compound Name | 5-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-chloro-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 136787482 |
| Molecular Formula | C12H10BrClN4O2 |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 5-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-chloro-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(N/N=C\c2ccc(O)c(Br)c2)c(Cl)c1=O |
| InChI | InChI=1S/C12H10BrClN4O2/c1-18-12(20)11(14)9(6-16-18)17-15-5-7-2-3-10(19)8(13)4-7/h2-6,17,19H,1H3/b15-5- |
| InChIKey | QIZMYEAYCAMMRL-WCSRMQSCSA-N |
| XLogP | 2.35 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|