C13H12Cl2N4O3 — CID 136787886
2-[(2Z)-2-[(3,5-dichloro-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 136787886) has the molecular formula C13H12Cl2N4O3 and a molecular weight of 343.17 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3,5-dichloro-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3,5-dichloro-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136787886 |
| Molecular Formula | C13H12Cl2N4O3 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-[(2Z)-2-[(3,5-dichloro-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N/N=C\c2cc(Cl)c(O)c(Cl)c2O)[nH]c(=O)c1C |
| InChI | InChI=1S/C13H12Cl2N4O3/c1-5-6(2)17-13(18-12(5)22)19-16-4-7-3-8(14)11(21)9(15)10(7)20/h3-4,20-21H,1-2H3,(H2,17,18,19,22)/b16-4- |
| InChIKey | FVGQTQVXFMVNDF-XRVIQIRUSA-N |
| XLogP | 2.55 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|