C15H17BrN4O3 — CID 136787917
2-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 136787917) has the molecular formula C15H17BrN4O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136787917 |
| Molecular Formula | C15H17BrN4O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[(2Z)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=N\Nc2nc(C)c(C)c(=O)[nH]2)cc(Br)c1O |
| InChI | InChI=1S/C15H17BrN4O3/c1-4-23-12-6-10(5-11(16)13(12)21)7-17-20-15-18-9(3)8(2)14(22)19-15/h5-7,21H,4H2,1-3H3,(H2,18,19,20,22)/b17-7- |
| InChIKey | NDDXXCOMEQNBCY-IDUWFGFVSA-N |
| XLogP | 2.70 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|