C16H13N3O2S — CID 136790926
2-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136790926) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136790926 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C1C[C@@H](c2nc3ccsc3c(=O)[nH]2)CN1c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2S/c20-13-8-10(9-19(13)11-4-2-1-3-5-11)15-17-12-6-7-22-14(12)16(21)18-15/h1-7,10H,8-9H2,(H,17,18,21)/t10-/m1/s1 |
| InChIKey | WRWFWESXZKYDLG-SNVBAGLBSA-N |
| XLogP | 2.51 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |