C21H24N4O2 — CID 136793154
(5S,7R)-7-(4-ethoxy-3-methoxyphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136793154) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5S,7R)-7-(4-ethoxy-3-methoxyphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-7-(4-ethoxy-3-methoxyphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136793154 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (5S,7R)-7-(4-ethoxy-3-methoxyphenyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOc1ccc([C@H]2C[C@@H](c3ccc(C)cc3)Nc3ncnn32)cc1OC |
| InChI | InChI=1S/C21H24N4O2/c1-4-27-19-10-9-16(11-20(19)26-3)18-12-17(15-7-5-14(2)6-8-15)24-21-22-13-23-25(18)21/h5-11,13,17-18H,4,12H2,1-3H3,(H,22,23,24)/t17-,18+/m0/s1 |
| InChIKey | PIGPTHGHFJNPTL-ZWKOTPCHSA-N |
| XLogP | 4.14 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |