C22H30N4O3 — CID 136795624
2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136795624) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136795624 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN2CCC(c3nc4c(c(=O)[nH]3)CCN(C)C4)CC2)cc1OC |
| InChI | InChI=1S/C22H30N4O3/c1-25-9-8-17-18(14-25)23-21(24-22(17)27)16-6-10-26(11-7-16)13-15-4-5-19(28-2)20(12-15)29-3/h4-5,12,16H,6-11,13-14H2,1-3H3,(H,23,24,27) |
| InChIKey | VQDICSFQGSHRSG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |