C18H21N5O2 — CID 136804352
(2S)-2-(2-ethylbenzimidazol-1-yl)-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]butanamide (PubChem CID 136804352) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (2S)-2-(2-ethylbenzimidazol-1-yl)-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]butanamide.
| Compound Name | (2S)-2-(2-ethylbenzimidazol-1-yl)-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 136804352 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2S)-2-(2-ethylbenzimidazol-1-yl)-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]butanamide |
| SMILES | CCc1nc2ccccc2n1[C@@H](CC)C(=O)NCc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C18H21N5O2/c1-3-14(18(25)19-10-12-9-17(24)21-11-20-12)23-15-8-6-5-7-13(15)22-16(23)4-2/h5-9,11,14H,3-4,10H2,1-2H3,(H,19,25)(H,20,21,24)/t14-/m0/s1 |
| InChIKey | NCSRNCVNDUTTSE-AWEZNQCLSA-N |
| XLogP | 1.95 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |