C13H19IN4O — CID 136805290
4-[cyclopropyl(piperidin-2-ylmethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136805290) has the molecular formula C13H19IN4O and a molecular weight of 374.23 g/mol. Its IUPAC name is 4-[cyclopropyl(piperidin-2-ylmethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[cyclopropyl(piperidin-2-ylmethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136805290 |
| Molecular Formula | C13H19IN4O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-[cyclopropyl(piperidin-2-ylmethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(CC2CCCCN2)C2CC2)c1I |
| InChI | InChI=1S/C13H19IN4O/c14-11-12(16-8-17-13(11)19)18(10-4-5-10)7-9-3-1-2-6-15-9/h8-10,15H,1-7H2,(H,16,17,19) |
| InChIKey | GAVXHLOHDVYOAK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|