C10H15IN4O — CID 136726430
4-(2,4-dimethylpiperazin-1-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136726430) has the molecular formula C10H15IN4O and a molecular weight of 334.16 g/mol. Its IUPAC name is 4-(2,4-dimethylpiperazin-1-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2,4-dimethylpiperazin-1-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726430 |
| Molecular Formula | C10H15IN4O |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-(2,4-dimethylpiperazin-1-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1CN(C)CCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H15IN4O/c1-7-5-14(2)3-4-15(7)9-8(11)10(16)13-6-12-9/h6-7H,3-5H2,1-2H3,(H,12,13,16) |
| InChIKey | PNMPASRGMPHBBD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|