C11H17IN4O — CID 136726420
4-(2,4-dimethyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136726420) has the molecular formula C11H17IN4O and a molecular weight of 348.19 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2,4-dimethyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726420 |
| Molecular Formula | C11H17IN4O |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-(2,4-dimethyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1CN(C)CCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H17IN4O/c1-8-6-15(2)4-3-5-16(8)10-9(12)11(17)14-7-13-10/h7-8H,3-6H2,1-2H3,(H,13,14,17) |
| InChIKey | KIIAXSHWTPYFTH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|