C12H19IN4O — CID 136726437
4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136726437) has the molecular formula C12H19IN4O and a molecular weight of 362.22 g/mol. Its IUPAC name is 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726437 |
| Molecular Formula | C12H19IN4O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 4-(2-ethyl-4-methyl-1,4-diazepan-1-yl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC1CN(C)CCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C12H19IN4O/c1-3-9-7-16(2)5-4-6-17(9)11-10(13)12(18)15-8-14-11/h8-9H,3-7H2,1-2H3,(H,14,15,18) |
| InChIKey | BASLZCAYVYLDBF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|