C10H12F3IN4O — CID 136957806
5-iodo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136957806) has the molecular formula C10H12F3IN4O and a molecular weight of 388.13 g/mol. Its IUPAC name is 5-iodo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957806 |
| Molecular Formula | C10H12F3IN4O |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 5-iodo-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCN(CC(F)(F)F)CC2)c1I |
| InChI | InChI=1S/C10H12F3IN4O/c11-10(12,13)5-17-1-3-18(4-2-17)8-7(14)9(19)16-6-15-8/h6H,1-5H2,(H,15,16,19) |
| InChIKey | PVHACAHEZREMAT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|