C15H20N4O2 — CID 136809356
6-amino-2-[(2-hydroxycyclohexyl)-methylamino]-3H-quinazolin-4-one (PubChem CID 136809356) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-amino-2-[(2-hydroxycyclohexyl)-methylamino]-3H-quinazolin-4-one.
| Compound Name | 6-amino-2-[(2-hydroxycyclohexyl)-methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136809356 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-amino-2-[(2-hydroxycyclohexyl)-methylamino]-3H-quinazolin-4-one |
| SMILES | CN(c1nc2ccc(N)cc2c(=O)[nH]1)C1CCCCC1O |
| InChI | InChI=1S/C15H20N4O2/c1-19(12-4-2-3-5-13(12)20)15-17-11-7-6-9(16)8-10(11)14(21)18-15/h6-8,12-13,20H,2-5,16H2,1H3,(H,17,18,21) |
| InChIKey | MSTAVPBHKBQSQN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|