C10H11IN4O2 — CID 136811579
4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136811579) has the molecular formula C10H11IN4O2 and a molecular weight of 346.13 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136811579 |
| Molecular Formula | C10H11IN4O2 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CNc2nc[nH]c(=O)c2I)oc1C |
| InChI | InChI=1S/C10H11IN4O2/c1-5-6(2)17-7(15-5)3-12-9-8(11)10(16)14-4-13-9/h4H,3H2,1-2H3,(H2,12,13,14,16) |
| InChIKey | BVXNMSJDSKCBHD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|