C14H15IN4O2 — CID 136956187
N-[2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-4-methylbenzamide (PubChem CID 136956187) has the molecular formula C14H15IN4O2 and a molecular weight of 398.20 g/mol. Its IUPAC name is N-[2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 136956187 |
| Molecular Formula | C14H15IN4O2 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | N-[2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2nc[nH]c(=O)c2I)cc1 |
| InChI | InChI=1S/C14H15IN4O2/c1-9-2-4-10(5-3-9)13(20)17-7-6-16-12-11(15)14(21)19-8-18-12/h2-5,8H,6-7H2,1H3,(H,17,20)(H2,16,18,19,21) |
| InChIKey | FZXAUONDCPQNPL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|