C10H10ClN3O2 — CID 136812230
5-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-2-methyl-1H-pyridin-4-one (PubChem CID 136812230) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 5-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-2-methyl-1H-pyridin-4-one.
| Compound Name | 5-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-2-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136812230 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-2-methyl-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(-c2nnc(C(C)Cl)o2)c[nH]1 |
| InChI | InChI=1S/C10H10ClN3O2/c1-5-3-8(15)7(4-12-5)10-14-13-9(16-10)6(2)11/h3-4,6H,1-2H3,(H,12,15) |
| InChIKey | DDKFAGFIEOSDEV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|