C16H14F5N9 — CID 136814129
10-methyl-4-[(5R,7R)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 136814129) has the molecular formula C16H14F5N9 and a molecular weight of 427.34 g/mol. Its IUPAC name is 10-methyl-4-[(5R,7R)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-4-[(5R,7R)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 136814129 |
| Molecular Formula | C16H14F5N9 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 10-methyl-4-[(5R,7R)-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | C[C@@H]1C[C@H](C(F)(F)C(F)(F)F)n2nc(-c3nc4c5cnn(C)c5ncn4n3)cc2N1 |
| InChI | InChI=1S/C16H14F5N9/c1-7-3-10(15(17,18)16(19,20)21)30-11(24-7)4-9(26-30)12-25-14-8-5-23-28(2)13(8)22-6-29(14)27-12/h4-7,10,24H,3H2,1-2H3/t7-,10-/m1/s1 |
| InChIKey | IWCFUHRISADRMF-GMSGAONNSA-N |
| XLogP | 2.82 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|