C19H21N3O3 — CID 136816225
13-(1,3-benzodioxol-5-ylmethyl)-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 136816225) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 13-(1,3-benzodioxol-5-ylmethyl)-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | 13-(1,3-benzodioxol-5-ylmethyl)-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 136816225 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 13-(1,3-benzodioxol-5-ylmethyl)-5-methyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CC1CCC(C2)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N3O3/c1-11-20-16-8-14-4-3-13(7-15(16)19(23)21-11)22(14)9-12-2-5-17-18(6-12)25-10-24-17/h2,5-6,13-14H,3-4,7-10H2,1H3,(H,20,21,23) |
| InChIKey | XOZKNKSRFKQQPL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |