C12H9FN4OS — CID 136816857
1-(4-fluoro-2-methylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136816857) has the molecular formula C12H9FN4OS and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136816857 |
| Molecular Formula | C12H9FN4OS |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1cc(F)ccc1-n1ncc2c(=O)[nH]c(=S)[nH]c21 |
| InChI | InChI=1S/C12H9FN4OS/c1-6-4-7(13)2-3-9(6)17-10-8(5-14-17)11(18)16-12(19)15-10/h2-5H,1H3,(H2,15,16,18,19) |
| InChIKey | SGLUASUDDSITJE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|