C18H19N5OS — CID 136820809
(4S)-4-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-methyl-5,7-dihydro-4H-[1,2]thiazolo[5,4-b]pyridin-6-one (PubChem CID 136820809) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is (4S)-4-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-methyl-5,7-dihydro-4H-[1,2]thiazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-methyl-5,7-dihydro-4H-[1,2]thiazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136820809 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (4S)-4-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]-3-methyl-5,7-dihydro-4H-[1,2]thiazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(C)c([C@@H]2CC(=O)Nc3snc(C)c32)cc1Cn1cncn1 |
| InChI | InChI=1S/C18H19N5OS/c1-10-4-11(2)14(5-13(10)7-23-9-19-8-20-23)15-6-16(24)21-18-17(15)12(3)22-25-18/h4-5,8-9,15H,6-7H2,1-3H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | MTELNJLYHGDMCY-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |