C18H20N8O — CID 136706846
3-[(1R)-1-[2-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]imidazol-1-yl]ethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136706846) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[(1R)-1-[2-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]imidazol-1-yl]ethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(1R)-1-[2-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]imidazol-1-yl]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136706846 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[(1R)-1-[2-[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]imidazol-1-yl]ethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | Cc1cc(C)c(-c2nccn2[C@H](C)c2n[nH]c(=O)[nH]2)cc1Cn1cncn1 |
| InChI | InChI=1S/C18H20N8O/c1-11-6-12(2)15(7-14(11)8-25-10-19-9-21-25)17-20-4-5-26(17)13(3)16-22-18(27)24-23-16/h4-7,9-10,13H,8H2,1-3H3,(H2,22,23,24,27)/t13-/m1/s1 |
| InChIKey | RSLIEIGLQCEAFL-CYBMUJFWSA-N |
| XLogP | 1.83 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |