C15H18ClN3O3 — CID 136821444
ethyl N-(2-amino-6-phenylmethoxypyridin-1-ium-3-yl)carbamate chloride (PubChem CID 136821444) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is ethyl N-(2-amino-6-phenylmethoxypyridin-1-ium-3-yl)carbamate chloride.
| Compound Name | ethyl N-(2-amino-6-phenylmethoxypyridin-1-ium-3-yl)carbamate chloride |
|---|---|
| PubChem CID | 136821444 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | ethyl N-(2-amino-6-phenylmethoxypyridin-1-ium-3-yl)carbamate chloride |
| SMILES | CCOC(=O)Nc1ccc(OCc2ccccc2)[nH+]c1N.[Cl-] |
| InChI | InChI=1S/C15H17N3O3.ClH/c1-2-20-15(19)17-12-8-9-13(18-14(12)16)21-10-11-6-4-3-5-7-11;/h3-9H,2,10H2,1H3,(H2,16,18)(H,17,19);1H |
| InChIKey | RJXDMWYCXKJONO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |