C16H19ClN4O2 — CID 136821880
prop-2-enyl N-[2-amino-6-(benzylamino)pyridin-1-ium-3-yl]carbamate chloride (PubChem CID 136821880) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is prop-2-enyl N-[2-amino-6-(benzylamino)pyridin-1-ium-3-yl]carbamate chloride.
| Compound Name | prop-2-enyl N-[2-amino-6-(benzylamino)pyridin-1-ium-3-yl]carbamate chloride |
|---|---|
| PubChem CID | 136821880 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | prop-2-enyl N-[2-amino-6-(benzylamino)pyridin-1-ium-3-yl]carbamate chloride |
| SMILES | C=CCOC(=O)Nc1ccc(NCc2ccccc2)[nH+]c1N.[Cl-] |
| InChI | InChI=1S/C16H18N4O2.ClH/c1-2-10-22-16(21)19-13-8-9-14(20-15(13)17)18-11-12-6-4-3-5-7-12;/h2-9H,1,10-11H2,(H,19,21)(H3,17,18,20);1H |
| InChIKey | QZLWTDJQAGDIRH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|