C19H18ClFN4O — CID 136821796
N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]benzamide chloride (PubChem CID 136821796) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]benzamide chloride.
| Compound Name | N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]benzamide chloride |
|---|---|
| PubChem CID | 136821796 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]benzamide chloride |
| SMILES | Nc1[nH+]c(NCc2ccc(F)cc2)ccc1NC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H17FN4O.ClH/c20-15-8-6-13(7-9-15)12-22-17-11-10-16(18(21)24-17)23-19(25)14-4-2-1-3-5-14;/h1-11H,12H2,(H,23,25)(H3,21,22,24);1H |
| InChIKey | BDBCCOVDRWVPFJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |