C20H23FN4O6 — CID 136821979
(Z)-4-hydroxy-4-oxobut-2-enoate;propan-2-yl N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]carbamate (PubChem CID 136821979) has the molecular formula C20H23FN4O6 and a molecular weight of 434.42 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;propan-2-yl N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]carbamate.
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;propan-2-yl N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]carbamate |
|---|---|
| PubChem CID | 136821979 |
| Molecular Formula | C20H23FN4O6 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;propan-2-yl N-[2-amino-6-[(4-fluorophenyl)methylamino]pyridin-1-ium-3-yl]carbamate |
| SMILES | CC(C)OC(=O)Nc1ccc(NCc2ccc(F)cc2)[nH+]c1N.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C16H19FN4O2.C4H4O4/c1-10(2)23-16(22)20-13-7-8-14(21-15(13)18)19-9-11-3-5-12(17)6-4-11;5-3(6)1-2-4(7)8/h3-8,10H,9H2,1-2H3,(H,20,22)(H3,18,19,21);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PCJBVTPYLABSIL-BTJKTKAUSA-N |
| XLogP | 1.17 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|