C12H14ClN3S — CID 136821583
6-benzylsulfanylpyridin-1-ium-2,3-diamine chloride (PubChem CID 136821583) has the molecular formula C12H14ClN3S and a molecular weight of 267.79 g/mol. Its IUPAC name is 6-benzylsulfanylpyridin-1-ium-2,3-diamine chloride.
| Compound Name | 6-benzylsulfanylpyridin-1-ium-2,3-diamine chloride |
|---|---|
| PubChem CID | 136821583 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.79 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-benzylsulfanylpyridin-1-ium-2,3-diamine chloride |
| SMILES | Nc1ccc(SCc2ccccc2)[nH+]c1N.[Cl-] |
| InChI | InChI=1S/C12H13N3S.ClH/c13-10-6-7-11(15-12(10)14)16-8-9-4-2-1-3-5-9;/h1-7H,8,13H2,(H2,14,15);1H |
| InChIKey | UKHNMKJUBPKYQR-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.79 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |