C12H18N4O2 — CID 136825653
3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136825653) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136825653 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N'-hydroxypyridine-4-carboximidamide |
| SMILES | C[C@@H]1CN(c2cnccc2/C(N)=N/O)C[C@H](C)O1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-6-16(7-9(2)18-8)11-5-14-4-3-10(11)12(13)15-17/h3-5,8-9,17H,6-7H2,1-2H3,(H2,13,15)/t8-,9+ |
| InChIKey | SYVYOLNUBFKBBG-DTORHVGOSA-N |
| XLogP | 0.79 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|