C11H19N5O — CID 136827334
5-amino-4-[3-aminopropyl(cyclobutyl)amino]-1H-pyrimidin-6-one (PubChem CID 136827334) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-amino-4-[3-aminopropyl(cyclobutyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[3-aminopropyl(cyclobutyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136827334 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 5-amino-4-[3-aminopropyl(cyclobutyl)amino]-1H-pyrimidin-6-one |
| SMILES | NCCCN(c1nc[nH]c(=O)c1N)C1CCC1 |
| InChI | InChI=1S/C11H19N5O/c12-5-2-6-16(8-3-1-4-8)10-9(13)11(17)15-7-14-10/h7-8H,1-6,12-13H2,(H,14,15,17) |
| InChIKey | TVLCJYYMZHSJQN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |